About 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide
3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide (PubChem CID 50742334) has the molecular formula C8H7ClIN3S
and a molecular weight of 339.59 g/mol. Its IUPAC name is 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide.
Molecular Properties
| Compound Name | 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide |
| PubChem CID | 50742334 |
| Molecular Formula | C8H7ClIN3S |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide |
| SMILES | C[n+]1cccc(-c2nsnc2Cl)c1.[I-] |
| InChI | InChI=1S/C8H7ClN3S.HI/c1-12-4-2-3-6(5-12)7-8(9)11-13-10-7;/h2-5H,1H3;1H/q+1;/p-1 |
| InChIKey | SKDWFKQVJIGJCO-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide?
The IUPAC name of 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide (CID 50742334) is 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide.
What is the SMILES notation for 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide?
The canonical SMILES for 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide is C[n+]1cccc(-c2nsnc2Cl)c1.[I-].
What is the InChIKey of 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide?
The InChIKey is SKDWFKQVJIGJCO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7ClN3S.HI/c1-12-4-2-3-6(5-12)7-8(9)11-13-10-7;/h2-5H,1H3;1H/q+1;/p-1.
What are the key properties of 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide?
3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide has a molecular weight of 339.59 g/mol, XLogP of -1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole iodide is sourced from PubChem (CID 50742334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).