About 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]
8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] (PubChem CID 50742421) has the molecular formula C15H16ClN3
and a molecular weight of 273.77 g/mol. Its IUPAC name is 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine].
Molecular Properties
| Compound Name | 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] |
| PubChem CID | 50742421 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] |
| SMILES | Clc1ccc2c(c1)-n1cccc1C1(CCNCC1)N2 |
| InChI | InChI=1S/C15H16ClN3/c16-11-3-4-12-13(10-11)19-9-1-2-14(19)15(18-12)5-7-17-8-6-15/h1-4,9-10,17-18H,5-8H2 |
| InChIKey | QETAJVVXEBGNHZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]?
The IUPAC name of 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] (CID 50742421) is 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine].
What is the SMILES notation for 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]?
The canonical SMILES for 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] is Clc1ccc2c(c1)-n1cccc1C1(CCNCC1)N2.
What is the InChIKey of 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]?
The InChIKey is QETAJVVXEBGNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3/c16-11-3-4-12-13(10-11)19-9-1-2-14(19)15(18-12)5-7-17-8-6-15/h1-4,9-10,17-18H,5-8H2.
What are the key properties of 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]?
8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] has a molecular weight of 273.77 g/mol, XLogP of 3.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorospiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] is sourced from PubChem (CID 50742421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).