C15H21N3 — CID 50742476
2-(2-methylpropyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-amine (PubChem CID 50742476) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-amine.
| Compound Name | 2-(2-methylpropyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 50742476 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-(2-methylpropyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-amine |
| SMILES | CC(C)CN1CCc2[nH]c3ccc(N)cc3c2C1 |
| InChI | InChI=1S/C15H21N3/c1-10(2)8-18-6-5-15-13(9-18)12-7-11(16)3-4-14(12)17-15/h3-4,7,10,17H,5-6,8-9,16H2,1-2H3 |
| InChIKey | LONYBNLBQLQHHF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|