About 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride
3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride (PubChem CID 50742546) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride |
| PubChem CID | 50742546 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride |
| SMILES | Cc1noc(C)c1CCC(=O)Cl |
| InChI | InChI=1S/C8H10ClNO2/c1-5-7(3-4-8(9)11)6(2)12-10-5/h3-4H2,1-2H3 |
| InChIKey | RNDWGRIZQAVFKZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride?
The IUPAC name of 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride (CID 50742546) is 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride.
What is the SMILES notation for 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride?
The canonical SMILES for 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride is Cc1noc(C)c1CCC(=O)Cl.
What is the InChIKey of 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride?
The InChIKey is RNDWGRIZQAVFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO2/c1-5-7(3-4-8(9)11)6(2)12-10-5/h3-4H2,1-2H3.
What are the key properties of 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride?
3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride has a molecular weight of 187.63 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl chloride is sourced from PubChem (CID 50742546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).