About 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid
4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 50743414) has the molecular formula C8H11N3O3S
and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| PubChem CID | 50743414 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | CCCNC(=O)c1nsc(C(=O)O)c1N |
| InChI | InChI=1S/C8H11N3O3S/c1-2-3-10-7(12)5-4(9)6(8(13)14)15-11-5/h2-3,9H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | ZFXSQXJJZMJOKY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid (CID 50743414) is 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid is CCCNC(=O)c1nsc(C(=O)O)c1N.
What is the InChIKey of 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The InChIKey is ZFXSQXJJZMJOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c1-2-3-10-7(12)5-4(9)6(8(13)14)15-11-5/h2-3,9H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid has a molecular weight of 229.26 g/mol, XLogP of 0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(propylcarbamoyl)-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 50743414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).