C24H20FNO3 — CID 50743760
2-(2-fluorophenyl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-3-phenyl-2H-pyrrol-5-one (PubChem CID 50743760) has the molecular formula C24H20FNO3 and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-3-phenyl-2H-pyrrol-5-one.
| Compound Name | 2-(2-fluorophenyl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 50743760 |
| Molecular Formula | C24H20FNO3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-(2-fluorophenyl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
| SMILES | COc1cccc(CN2C(=O)C(O)=C(c3ccccc3)C2c2ccccc2F)c1 |
| InChI | InChI=1S/C24H20FNO3/c1-29-18-11-7-8-16(14-18)15-26-22(19-12-5-6-13-20(19)25)21(23(27)24(26)28)17-9-3-2-4-10-17/h2-14,22,27H,15H2,1H3 |
| InChIKey | AUKOITZWDIOFMH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |