C20H21F2N3O2S — CID 50744077
N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide (PubChem CID 50744077) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide.
| Compound Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 50744077 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide |
| SMILES | CCCCSc1cc2c(cc1NC(=O)c1c(F)cccc1F)n(C)c(=O)n2C |
| InChI | InChI=1S/C20H21F2N3O2S/c1-4-5-9-28-17-11-16-15(24(2)20(27)25(16)3)10-14(17)23-19(26)18-12(21)7-6-8-13(18)22/h6-8,10-11H,4-5,9H2,1-3H3,(H,23,26) |
| InChIKey | GEOOMYCHLPKFMO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|