About N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide
N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 50745190) has the molecular formula C14H20N4OS
and a molecular weight of 292.41 g/mol. Its IUPAC name is N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 50745190 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCNC(=O)c1sc(-n2nc(C)cc2C)nc1C |
| InChI | InChI=1S/C14H20N4OS/c1-5-6-7-15-13(19)12-11(4)16-14(20-12)18-10(3)8-9(2)17-18/h8H,5-7H2,1-4H3,(H,15,19) |
| InChIKey | VCQDZCDKRPZTPU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide (CID 50745190) is N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide is CCCCNC(=O)c1sc(-n2nc(C)cc2C)nc1C.
What is the InChIKey of N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is VCQDZCDKRPZTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4OS/c1-5-6-7-15-13(19)12-11(4)16-14(20-12)18-10(3)8-9(2)17-18/h8H,5-7H2,1-4H3,(H,15,19).
What are the key properties of N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide?
N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 292.41 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(3,5-dimethylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 50745190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).