C25H28N4O4S — CID 50745234
2-[3-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-6-oxopyridazin-1-yl]-N-phenylpropanamide (PubChem CID 50745234) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[3-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-6-oxopyridazin-1-yl]-N-phenylpropanamide.
| Compound Name | 2-[3-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-6-oxopyridazin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 50745234 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[3-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-6-oxopyridazin-1-yl]-N-phenylpropanamide |
| SMILES | Cc1ccc(-c2ccc(=O)n(C(C)C(=O)Nc3ccccc3)n2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H28N4O4S/c1-18-11-12-20(17-23(18)34(32,33)28-15-7-4-8-16-28)22-13-14-24(30)29(27-22)19(2)25(31)26-21-9-5-3-6-10-21/h3,5-6,9-14,17,19H,4,7-8,15-16H2,1-2H3,(H,26,31) |
| InChIKey | OWMZARBQESHGMH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |