About 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine
2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 5074564) has the molecular formula C22H26BrN3
and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| PubChem CID | 5074564 |
| Molecular Formula | C22H26BrN3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | Cc1ccc(CN2CCN(N=CC(Br)=Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H26BrN3/c1-18-8-9-21(19(2)14-18)17-25-10-12-26(13-11-25)24-16-22(23)15-20-6-4-3-5-7-20/h3-9,14-16H,10-13,17H2,1-2H3 |
| InChIKey | JHCAOIGVSWSXLG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine?
The IUPAC name of 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine (CID 5074564) is 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine.
What is the SMILES notation for 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine?
The canonical SMILES for 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine is Cc1ccc(CN2CCN(N=CC(Br)=Cc3ccccc3)CC2)c(C)c1.
What is the InChIKey of 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine?
The InChIKey is JHCAOIGVSWSXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26BrN3/c1-18-8-9-21(19(2)14-18)17-25-10-12-26(13-11-25)24-16-22(23)15-20-6-4-3-5-7-20/h3-9,14-16H,10-13,17H2,1-2H3.
What are the key properties of 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine?
2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine has a molecular weight of 412.38 g/mol, XLogP of 4.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine is sourced from PubChem (CID 5074564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).