C23H18N4O6 — CID 50745972
2-[2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-nitrophenyl)acetamide (PubChem CID 50745972) has the molecular formula C23H18N4O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-[2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 50745972 |
| Molecular Formula | C23H18N4O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenoxy]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2noc(-c3ccccc3OCC(=O)Nc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C23H18N4O6/c1-31-18-12-6-15(7-13-18)22-25-23(33-26-22)19-4-2-3-5-20(19)32-14-21(28)24-16-8-10-17(11-9-16)27(29)30/h2-13H,14H2,1H3,(H,24,28) |
| InChIKey | DSAPIQCCLUKKCZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|