C27H26N4O3 — CID 50747281
2-[3-(2-acetamido-5-methylphenyl)-2-oxoquinoxalin-1-yl]-N-(2-methylphenyl)propanamide (PubChem CID 50747281) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[3-(2-acetamido-5-methylphenyl)-2-oxoquinoxalin-1-yl]-N-(2-methylphenyl)propanamide.
| Compound Name | 2-[3-(2-acetamido-5-methylphenyl)-2-oxoquinoxalin-1-yl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 50747281 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[3-(2-acetamido-5-methylphenyl)-2-oxoquinoxalin-1-yl]-N-(2-methylphenyl)propanamide |
| SMILES | CC(=O)Nc1ccc(C)cc1-c1nc2ccccc2n(C(C)C(=O)Nc2ccccc2C)c1=O |
| InChI | InChI=1S/C27H26N4O3/c1-16-13-14-22(28-19(4)32)20(15-16)25-27(34)31(24-12-8-7-11-23(24)29-25)18(3)26(33)30-21-10-6-5-9-17(21)2/h5-15,18H,1-4H3,(H,28,32)(H,30,33) |
| InChIKey | WTVRDIWDDWIIMZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |