C14H18ClNO — CID 50747298
1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 50747298) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 50747298 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO/c1-10(2)14(17)16-9-3-4-13(16)11-5-7-12(15)8-6-11/h5-8,10,13H,3-4,9H2,1-2H3 |
| InChIKey | ZHVPKOGNLBNLGX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |