About (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone
(2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 50747398) has the molecular formula C18H16ClF2NO2
and a molecular weight of 351.78 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 50747398 |
| Molecular Formula | C18H16ClF2NO2 |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16ClF2NO2/c1-24-12-6-4-11(5-7-12)17-3-2-8-22(17)18(23)13-9-15(20)16(21)10-14(13)19/h4-7,9-10,17H,2-3,8H2,1H3 |
| InChIKey | WEFWYAPKPCFVQW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone?
The IUPAC name of (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone (CID 50747398) is (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone is COc1ccc(C2CCCN2C(=O)c2cc(F)c(F)cc2Cl)cc1.
What is the InChIKey of (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone?
The InChIKey is WEFWYAPKPCFVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF2NO2/c1-24-12-6-4-11(5-7-12)17-3-2-8-22(17)18(23)13-9-15(20)16(21)10-14(13)19/h4-7,9-10,17H,2-3,8H2,1H3.
What are the key properties of (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone?
(2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone has a molecular weight of 351.78 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4,5-difluorophenyl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 50747398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).