C17H23N3O4S — CID 50747609
5-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-ethyl-1,2,4-oxadiazole (PubChem CID 50747609) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 5-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-ethyl-1,2,4-oxadiazole.
| Compound Name | 5-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 50747609 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-ethyl-1,2,4-oxadiazole |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCCC2)cc1-c1nc(CC)no1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-16-18-17(24-19-16)14-12-13(8-9-15(14)23-4-2)25(21,22)20-10-6-5-7-11-20/h8-9,12H,3-7,10-11H2,1-2H3 |
| InChIKey | NENUYTYQBCNJBA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |