C21H18N6O4 — CID 50749079
N-[(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-N-(4-methylphenyl)-3-nitrobenzamide (PubChem CID 50749079) has the molecular formula C21H18N6O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is N-[(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-N-(4-methylphenyl)-3-nitrobenzamide.
| Compound Name | N-[(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-N-(4-methylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 50749079 |
| Molecular Formula | C21H18N6O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-N-(4-methylphenyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(N(Cc2nc3nc(C)cc(=O)n3[nH]2)C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H18N6O4/c1-13-6-8-16(9-7-13)25(20(29)15-4-3-5-17(11-15)27(30)31)12-18-23-21-22-14(2)10-19(28)26(21)24-18/h3-11H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | CYFLBCMWCISHAH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|