C15H14N4O3S2 — CID 50749615
N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 50749615) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50749615 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | O=C(NC1=NCCS1)c1c(-c2ccccc2)nc2n1CCS2(=O)=O |
| InChI | InChI=1S/C15H14N4O3S2/c20-13(18-14-16-6-8-23-14)12-11(10-4-2-1-3-5-10)17-15-19(12)7-9-24(15,21)22/h1-5H,6-9H2,(H,16,18,20) |
| InChIKey | OZDYDBWFXIPADH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |