C21H31N5O2 — CID 50750465
1-cyclohexyl-3-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]urea (PubChem CID 50750465) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]urea |
|---|---|
| PubChem CID | 50750465 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-cyclohexyl-3-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]urea |
| SMILES | COCCCN1CCn2c(nc3cc(NC(=O)NC4CCCCC4)ccc32)C1 |
| InChI | InChI=1S/C21H31N5O2/c1-28-13-5-10-25-11-12-26-19-9-8-17(14-18(19)24-20(26)15-25)23-21(27)22-16-6-3-2-4-7-16/h8-9,14,16H,2-7,10-13,15H2,1H3,(H2,22,23,27) |
| InChIKey | GVYHCIHBFVHBSW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|