C19H18ClN3O2S — CID 5075128
N-(4-chlorophenyl)-4,9-dimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 5075128) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4,9-dimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4,9-dimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 5075128 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-(4-chlorophenyl)-4,9-dimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | Cc1ccc2c(c1)C1NC(=S)NC(C)(O2)C1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-10-3-8-14-13(9-10)16-15(19(2,25-14)23-18(26)22-16)17(24)21-12-6-4-11(20)5-7-12/h3-9,15-16H,1-2H3,(H,21,24)(H2,22,23,26) |
| InChIKey | SGASQZHAKQZCRU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|