C22H18N4O5 — CID 50751574
6-(2,5-dimethoxyphenyl)-5-(2-oxo-1,3-dihydroindol-3-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 50751574) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-5-(2-oxo-1,3-dihydroindol-3-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2,5-dimethoxyphenyl)-5-(2-oxo-1,3-dihydroindol-3-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 50751574 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-5-(2-oxo-1,3-dihydroindol-3-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(OC)c(-c2[nH]c3[nH]c(=O)[nH]c(=O)c3c2C2C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C22H18N4O5/c1-30-10-7-8-14(31-2)12(9-10)18-16(17-19(24-18)25-22(29)26-21(17)28)15-11-5-3-4-6-13(11)23-20(15)27/h3-9,15H,1-2H3,(H,23,27)(H3,24,25,26,28,29) |
| InChIKey | RJLROCJRYBETKD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |