C31H48N4O7S — CID 507527
(4S)-4-(3-cyclopentylpropanoylamino)-5-[[(2S)-1-[[(2R)-1-[2-(4-methoxyphenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 507527) has the molecular formula C31H48N4O7S and a molecular weight of 620.81 g/mol. Its IUPAC name is (4S)-4-(3-cyclopentylpropanoylamino)-5-[[(2S)-1-[[(2R)-1-[2-(4-methoxyphenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-(3-cyclopentylpropanoylamino)-5-[[(2S)-1-[[(2R)-1-[2-(4-methoxyphenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 507527 |
| Molecular Formula | C31H48N4O7S |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | (4S)-4-(3-cyclopentylpropanoylamino)-5-[[(2S)-1-[[(2R)-1-[2-(4-methoxyphenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | COc1ccc(CCNC(=O)[C@H](CS)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C31H48N4O7S/c1-20(2)18-25(31(41)35-26(19-43)29(39)32-17-16-22-8-11-23(42-3)12-9-22)34-30(40)24(13-15-28(37)38)33-27(36)14-10-21-6-4-5-7-21/h8-9,11-12,20-21,24-26,43H,4-7,10,13-19H2,1-3H3,(H,32,39)(H,33,36)(H,34,40)(H,35,41)(H,37,38)/t24-,25-,26-/m0/s1 |
| InChIKey | MCNOLAKOALIIGU-GSDHBNRESA-N |
| XLogP | 2.62 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|