C17H20N2O2S — CID 50753385
N-cyclopentyl-4-methyl-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide (PubChem CID 50753385) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-cyclopentyl-4-methyl-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-cyclopentyl-4-methyl-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50753385 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-cyclopentyl-4-methyl-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(COc2ccccc2)sc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-16(17(20)19-13-7-5-6-8-13)22-15(18-12)11-21-14-9-3-2-4-10-14/h2-4,9-10,13H,5-8,11H2,1H3,(H,19,20) |
| InChIKey | NZWWSLTYGIREPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |