C23H27N5O2 — CID 50753834
11-(4-methylphenyl)-8-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-one (PubChem CID 50753834) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 11-(4-methylphenyl)-8-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-one.
| Compound Name | 11-(4-methylphenyl)-8-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-one |
|---|---|
| PubChem CID | 50753834 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 11-(4-methylphenyl)-8-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-2-one |
| SMILES | Cc1ccc(-c2nc3n(CC(=O)N4CCC(C)CC4)c4c(c(=O)n3n2)CCC4)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-15-6-8-17(9-7-15)21-24-23-27(14-20(29)26-12-10-16(2)11-13-26)19-5-3-4-18(19)22(30)28(23)25-21/h6-9,16H,3-5,10-14H2,1-2H3 |
| InChIKey | VCTGPNJQDJDOPN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |