C20H23N5O2 — CID 50754031
N-(2-methylpropyl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide (PubChem CID 50754031) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide.
| Compound Name | N-(2-methylpropyl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide |
|---|---|
| PubChem CID | 50754031 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-(2-methylpropyl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide |
| SMILES | CC(C)CNC(=O)Cn1c2c(c(=O)n3nc(-c4ccccc4)nc13)CCC2 |
| InChI | InChI=1S/C20H23N5O2/c1-13(2)11-21-17(26)12-24-16-10-6-9-15(16)19(27)25-20(24)22-18(23-25)14-7-4-3-5-8-14/h3-5,7-8,13H,6,9-12H2,1-2H3,(H,21,26) |
| InChIKey | CWDHAYXNSJOBAE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |