About 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole
2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole (PubChem CID 50754084) has the molecular formula C18H19ClN2O
and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole |
| PubChem CID | 50754084 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole |
| SMILES | CCc1ccc2nc(COc3cc(C)c(Cl)c(C)c3)[nH]c2c1 |
| InChI | InChI=1S/C18H19ClN2O/c1-4-13-5-6-15-16(9-13)21-17(20-15)10-22-14-7-11(2)18(19)12(3)8-14/h5-9H,4,10H2,1-3H3,(H,20,21) |
| InChIKey | OUELQENLYMMVQP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole?
The IUPAC name of 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole (CID 50754084) is 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole.
What is the SMILES notation for 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole?
The canonical SMILES for 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole is CCc1ccc2nc(COc3cc(C)c(Cl)c(C)c3)[nH]c2c1.
What is the InChIKey of 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole?
The InChIKey is OUELQENLYMMVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O/c1-4-13-5-6-15-16(9-13)21-17(20-15)10-22-14-7-11(2)18(19)12(3)8-14/h5-9H,4,10H2,1-3H3,(H,20,21).
What are the key properties of 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole?
2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole has a molecular weight of 314.82 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-3,5-dimethylphenoxy)methyl]-6-ethyl-1H-benzimidazole is sourced from PubChem (CID 50754084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).