C25H31N3O2 — CID 50754249
N-cyclohexyl-4-[3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]benzamide (PubChem CID 50754249) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]benzamide.
| Compound Name | N-cyclohexyl-4-[3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]benzamide |
|---|---|
| PubChem CID | 50754249 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-cyclohexyl-4-[3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]benzamide |
| SMILES | Cc1cccc(CN2CCCN(c3ccc(C(=O)NC4CCCCC4)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-19-7-5-8-20(17-19)18-27-15-6-16-28(25(27)30)23-13-11-21(12-14-23)24(29)26-22-9-3-2-4-10-22/h5,7-8,11-14,17,22H,2-4,6,9-10,15-16,18H2,1H3,(H,26,29) |
| InChIKey | RBYDGNCTQXEUFY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |