C14H15N3O3 — CID 50755671
2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-prop-2-enylacetamide (PubChem CID 50755671) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 50755671 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1cccc(-c2noc(C)n2)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-3-7-15-13(18)9-19-12-6-4-5-11(8-12)14-16-10(2)20-17-14/h3-6,8H,1,7,9H2,2H3,(H,15,18) |
| InChIKey | WDIDJUURVRTHPA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|