C16H15F9N2O2 — CID 5075604
2,2,3,3,4,4,5,5,5-nonafluoro-1-[4-(2-methoxyphenyl)piperazin-1-yl]pentan-1-one (PubChem CID 5075604) has the molecular formula C16H15F9N2O2 and a molecular weight of 438.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-[4-(2-methoxyphenyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-[4-(2-methoxyphenyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 5075604 |
| Molecular Formula | C16H15F9N2O2 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-[4-(2-methoxyphenyl)piperazin-1-yl]pentan-1-one |
| SMILES | COc1ccccc1N1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H15F9N2O2/c1-29-11-5-3-2-4-10(11)26-6-8-27(9-7-26)12(28)13(17,18)14(19,20)15(21,22)16(23,24)25/h2-5H,6-9H2,1H3 |
| InChIKey | KYLJGOSAMOUXSS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|