C27H33N3O4S — CID 50756216
10-[(2,3-dimethoxyphenyl)methyl]-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 50756216) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 10-[(2,3-dimethoxyphenyl)methyl]-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | 10-[(2,3-dimethoxyphenyl)methyl]-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 50756216 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 10-[(2,3-dimethoxyphenyl)methyl]-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | COc1cccc(CN2C(=O)c3cc4sccc4n3CC2(C)C(=O)NC2CCCCC2C)c1OC |
| InChI | InChI=1S/C27H33N3O4S/c1-17-8-5-6-10-19(17)28-26(32)27(2)16-29-20-12-13-35-23(20)14-21(29)25(31)30(27)15-18-9-7-11-22(33-3)24(18)34-4/h7,9,11-14,17,19H,5-6,8,10,15-16H2,1-4H3,(H,28,32) |
| InChIKey | IRLBNMVFDSNNMG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |