C26H31N3O4S — CID 50756230
N-cyclopentyl-10-[2-(2,5-dimethoxyphenyl)ethyl]-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 50756230) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-cyclopentyl-10-[2-(2,5-dimethoxyphenyl)ethyl]-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | N-cyclopentyl-10-[2-(2,5-dimethoxyphenyl)ethyl]-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 50756230 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-cyclopentyl-10-[2-(2,5-dimethoxyphenyl)ethyl]-11-methyl-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | COc1ccc(OC)c(CCN2C(=O)c3cc4sccc4n3CC2(C)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C26H31N3O4S/c1-26(25(31)27-18-6-4-5-7-18)16-28-20-11-13-34-23(20)15-21(28)24(30)29(26)12-10-17-14-19(32-2)8-9-22(17)33-3/h8-9,11,13-15,18H,4-7,10,12,16H2,1-3H3,(H,27,31) |
| InChIKey | AQKRWEKMSPYVED-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |