C28H35N3O4 — CID 50756808
N-(2,3-dimethylcyclohexyl)-10-[(4-ethoxyphenyl)methyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 50756808) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-10-[(4-ethoxyphenyl)methyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-10-[(4-ethoxyphenyl)methyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 50756808 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-10-[(4-ethoxyphenyl)methyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCOc1ccc(CN2C(=O)c3cc4occc4n3CC2(C)C(=O)NC2CCCC(C)C2C)cc1 |
| InChI | InChI=1S/C28H35N3O4/c1-5-34-21-11-9-20(10-12-21)16-31-26(32)24-15-25-23(13-14-35-25)30(24)17-28(31,4)27(33)29-22-8-6-7-18(2)19(22)3/h9-15,18-19,22H,5-8,16-17H2,1-4H3,(H,29,33) |
| InChIKey | WGZNBKRJUIAQFK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |