About 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one
7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one (PubChem CID 50756999) has the molecular formula C20H23BrN4O2
and a molecular weight of 431.33 g/mol. Its IUPAC name is 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one |
| PubChem CID | 50756999 |
| Molecular Formula | C20H23BrN4O2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one |
| SMILES | CN1CCN(C(=O)CCCn2c(=O)c3cccn3c3ccc(Br)cc32)CC1 |
| InChI | InChI=1S/C20H23BrN4O2/c1-22-10-12-23(13-11-22)19(26)5-3-9-25-18-14-15(21)6-7-16(18)24-8-2-4-17(24)20(25)27/h2,4,6-8,14H,3,5,9-13H2,1H3 |
| InChIKey | GFXHWUDNSGVRCB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one?
The IUPAC name of 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one (CID 50756999) is 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one.
What is the SMILES notation for 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one?
The canonical SMILES for 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one is CN1CCN(C(=O)CCCn2c(=O)c3cccn3c3ccc(Br)cc32)CC1.
What is the InChIKey of 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one?
The InChIKey is GFXHWUDNSGVRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrN4O2/c1-22-10-12-23(13-11-22)19(26)5-3-9-25-18-14-15(21)6-7-16(18)24-8-2-4-17(24)20(25)27/h2,4,6-8,14H,3,5,9-13H2,1H3.
What are the key properties of 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one?
7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one has a molecular weight of 431.33 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]pyrrolo[1,2-a]quinoxalin-4-one is sourced from PubChem (CID 50756999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).