C26H24N4O2 — CID 50760121
(4-benzhydrylpiperazin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone (PubChem CID 50760121) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 50760121 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccnc2)on1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24N4O2/c31-26(23-18-24(32-28-23)22-12-7-13-27-19-22)30-16-14-29(15-17-30)25(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18-19,25H,14-17H2 |
| InChIKey | HYXQTNIWNAOGBZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |