C20H14F7N3O2 — CID 50760727
2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 50760727) has the molecular formula C20H14F7N3O2 and a molecular weight of 461.34 g/mol. Its IUPAC name is 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 50760727 |
| Molecular Formula | C20H14F7N3O2 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | Cc1cc2nc(C(F)(F)F)c(=O)n(C(C)C(=O)Nc3c(F)c(F)cc(F)c3F)c2cc1C |
| InChI | InChI=1S/C20H14F7N3O2/c1-7-4-12-13(5-8(7)2)30(19(32)17(28-12)20(25,26)27)9(3)18(31)29-16-14(23)10(21)6-11(22)15(16)24/h4-6,9H,1-3H3,(H,29,31) |
| InChIKey | IEXPBJLTDSARRD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|