C21H27FN4O2S — CID 5076078
3-butyl-1-[2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-1-(2-methoxyethyl)urea (PubChem CID 5076078) has the molecular formula C21H27FN4O2S and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-butyl-1-[2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-1-(2-methoxyethyl)urea.
| Compound Name | 3-butyl-1-[2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 5076078 |
| Molecular Formula | C21H27FN4O2S |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-butyl-1-[2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-1-(2-methoxyethyl)urea |
| SMILES | CCCCNC(=O)N(CCOC)CCc1csc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C21H27FN4O2S/c1-3-4-10-23-20(27)25(12-13-28-2)11-9-18-15-29-21-24-19(14-26(18)21)16-5-7-17(22)8-6-16/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,23,27) |
| InChIKey | PGPCTHIIDYMJCO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|