C27H20N4O5S — CID 5076234
2-(2,4-dimethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]quinoline-4-carboxamide (PubChem CID 5076234) has the molecular formula C27H20N4O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5076234 |
| Molecular Formula | C27H20N4O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3nc(-c4ccc([N+](=O)[O-])cc4)cs3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C27H20N4O5S/c1-35-18-11-12-20(25(13-18)36-2)23-14-21(19-5-3-4-6-22(19)28-23)26(32)30-27-29-24(15-37-27)16-7-9-17(10-8-16)31(33)34/h3-15H,1-2H3,(H,29,30,32) |
| InChIKey | IIAJIUWGPVHHQP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|