About 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one
1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one (PubChem CID 5076486) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one |
| PubChem CID | 5076486 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one |
| SMILES | Cc1ccc(CN2CCCNC2=O)cc1 |
| InChI | InChI=1S/C12H16N2O/c1-10-3-5-11(6-4-10)9-14-8-2-7-13-12(14)15/h3-6H,2,7-9H2,1H3,(H,13,15) |
| InChIKey | XAKRTOIHMJCULO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one?
The IUPAC name of 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one (CID 5076486) is 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one is Cc1ccc(CN2CCCNC2=O)cc1.
What is the InChIKey of 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one?
The InChIKey is XAKRTOIHMJCULO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-10-3-5-11(6-4-10)9-14-8-2-7-13-12(14)15/h3-6H,2,7-9H2,1H3,(H,13,15).
What are the key properties of 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one?
1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one has a molecular weight of 204.27 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methylphenyl)methyl]-1,3-diazinan-2-one is sourced from PubChem (CID 5076486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).