About methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate
methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate (PubChem CID 50765071) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate |
| PubChem CID | 50765071 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate |
| SMILES | COC(=O)c1nc2ccccc2nc1N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H19N3O2/c1-26-21(25)19-20(23-18-10-6-5-9-17(18)22-19)24-13-11-16(12-14-24)15-7-3-2-4-8-15/h2-11H,12-14H2,1H3 |
| InChIKey | JBHZETRYKWTRNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate?
The IUPAC name of methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate (CID 50765071) is methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate.
What is the SMILES notation for methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate?
The canonical SMILES for methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate is COC(=O)c1nc2ccccc2nc1N1CC=C(c2ccccc2)CC1.
What is the InChIKey of methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate?
The InChIKey is JBHZETRYKWTRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-26-21(25)19-20(23-18-10-6-5-9-17(18)22-19)24-13-11-16(12-14-24)15-7-3-2-4-8-15/h2-11H,12-14H2,1H3.
What are the key properties of methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate?
methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate has a molecular weight of 345.40 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)quinoxaline-2-carboxylate is sourced from PubChem (CID 50765071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).