C22H23N3O2S — CID 50765974
N-(2-ethylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide (PubChem CID 50765974) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide.
| Compound Name | N-(2-ethylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
|---|---|
| PubChem CID | 50765974 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(2-ethylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1CC2CSCN2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H23N3O2S/c1-2-14-7-3-5-9-18(14)23-20(26)17-11-15-12-28-13-25(15)22(17)16-8-4-6-10-19(16)24-21(22)27/h3-10,15,17H,2,11-13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | VUJPEZHPMKLEDB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |