C21H21N3O2S — CID 50765979
N-(2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide (PubChem CID 50765979) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide.
| Compound Name | N-(2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
|---|---|
| PubChem CID | 50765979 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-(2-methylphenyl)-2-oxospiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-6'-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1CC2CSCN2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H21N3O2S/c1-13-6-2-4-8-17(13)22-19(25)16-10-14-11-27-12-24(14)21(16)15-7-3-5-9-18(15)23-20(21)26/h2-9,14,16H,10-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | BCHBUMSXQABCFR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |