C23H26F2N4O4S — CID 50766939
5-[(2,5-difluorophenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid (PubChem CID 50766939) has the molecular formula C23H26F2N4O4S and a molecular weight of 492.55 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid.
| Compound Name | 5-[(2,5-difluorophenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50766939 |
| Molecular Formula | C23H26F2N4O4S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 5-[(2,5-difluorophenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid |
| SMILES | Cc1nn(C)c(C)c1CCCN(C)c1ccc(NS(=O)(=O)c2cc(F)ccc2F)cc1C(=O)O |
| InChI | InChI=1S/C23H26F2N4O4S/c1-14-18(15(2)29(4)26-14)6-5-11-28(3)21-10-8-17(13-19(21)23(30)31)27-34(32,33)22-12-16(24)7-9-20(22)25/h7-10,12-13,27H,5-6,11H2,1-4H3,(H,30,31) |
| InChIKey | BMZGGZZTENGFOL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|