About 1-phenyl-3,4-dihydroquinolin-2-one
1-phenyl-3,4-dihydroquinolin-2-one (PubChem CID 5076748) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-phenyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1-phenyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 5076748 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-phenyl-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C15H13NO/c17-15-11-10-12-6-4-5-9-14(12)16(15)13-7-2-1-3-8-13/h1-9H,10-11H2 |
| InChIKey | KZVGADOBXOOISP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 1-phenyl-3,4-dihydroquinolin-2-one (CID 5076748) is 1-phenyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1-phenyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1-phenyl-3,4-dihydroquinolin-2-one is O=C1CCc2ccccc2N1c1ccccc1.
What is the InChIKey of 1-phenyl-3,4-dihydroquinolin-2-one?
The InChIKey is KZVGADOBXOOISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO/c17-15-11-10-12-6-4-5-9-14(12)16(15)13-7-2-1-3-8-13/h1-9H,10-11H2.
What are the key properties of 1-phenyl-3,4-dihydroquinolin-2-one?
1-phenyl-3,4-dihydroquinolin-2-one has a molecular weight of 223.28 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 5076748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).