C20H18FN3O2 — CID 50767516
4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-N-(3-fluorophenyl)benzamide (PubChem CID 50767516) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-N-(3-fluorophenyl)benzamide.
| Compound Name | 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 50767516 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc(-c2noc(C3CCCC3)n2)cc1 |
| InChI | InChI=1S/C20H18FN3O2/c21-16-6-3-7-17(12-16)22-19(25)14-10-8-13(9-11-14)18-23-20(26-24-18)15-4-1-2-5-15/h3,6-12,15H,1-2,4-5H2,(H,22,25) |
| InChIKey | SZBHZMZKWCCRCP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |