C26H27N3O3 — CID 50767868
2-benzyl-N-cyclohexyl-3-methyl-1,4-dioxopyrazino[1,2-a]indole-3-carboxamide (PubChem CID 50767868) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-benzyl-N-cyclohexyl-3-methyl-1,4-dioxopyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | 2-benzyl-N-cyclohexyl-3-methyl-1,4-dioxopyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 50767868 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-benzyl-N-cyclohexyl-3-methyl-1,4-dioxopyrazino[1,2-a]indole-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)C(=O)n2c(cc3ccccc32)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O3/c1-26(24(31)27-20-13-6-3-7-14-20)25(32)29-21-15-9-8-12-19(21)16-22(29)23(30)28(26)17-18-10-4-2-5-11-18/h2,4-5,8-12,15-16,20H,3,6-7,13-14,17H2,1H3,(H,27,31) |
| InChIKey | WNWHVWDCKMNYDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|