C23H19FN4O2S2 — CID 50770329
8-[(2-ethoxyphenyl)methyl]-12-[(2-fluorophenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 50770329) has the molecular formula C23H19FN4O2S2 and a molecular weight of 466.56 g/mol. Its IUPAC name is 8-[(2-ethoxyphenyl)methyl]-12-[(2-fluorophenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 8-[(2-ethoxyphenyl)methyl]-12-[(2-fluorophenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 50770329 |
| Molecular Formula | C23H19FN4O2S2 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 8-[(2-ethoxyphenyl)methyl]-12-[(2-fluorophenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | CCOc1ccccc1Cn1c(=O)c2sccc2n2c(SCc3ccccc3F)nnc12 |
| InChI | InChI=1S/C23H19FN4O2S2/c1-2-30-19-10-6-4-7-15(19)13-27-21(29)20-18(11-12-31-20)28-22(27)25-26-23(28)32-14-16-8-3-5-9-17(16)24/h3-12H,2,13-14H2,1H3 |
| InChIKey | TWDWTSACOXRFQZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |