About ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate
ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 50771586) has the molecular formula C12H11F2N3O4S
and a molecular weight of 331.30 g/mol. Its IUPAC name is ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| PubChem CID | 50771586 |
| Molecular Formula | C12H11F2N3O4S |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H11F2N3O4S/c1-2-21-12(18)8-6-15-16-11(8)22(19,20)17-7-3-4-9(13)10(14)5-7/h3-6,17H,2H2,1H3,(H,15,16) |
| InChIKey | BKEDDZWMVFESJU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate (CID 50771586) is ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The InChIKey is BKEDDZWMVFESJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2N3O4S/c1-2-21-12(18)8-6-15-16-11(8)22(19,20)17-7-3-4-9(13)10(14)5-7/h3-6,17H,2H2,1H3,(H,15,16).
What are the key properties of ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate has a molecular weight of 331.30 g/mol, XLogP of 1.67, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(3,4-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 50771586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).