C14H12FN3S — CID 50772078
4-ethylsulfanyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazine (PubChem CID 50772078) has the molecular formula C14H12FN3S and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazine.
| Compound Name | 4-ethylsulfanyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 50772078 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-ethylsulfanyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyrazine |
| SMILES | CCSc1nccn2nc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C14H12FN3S/c1-2-19-14-13-9-12(17-18(13)8-7-16-14)10-3-5-11(15)6-4-10/h3-9H,2H2,1H3 |
| InChIKey | GCRWJXWJFRHTLO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |