About 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine
2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine (PubChem CID 50772101) has the molecular formula C17H19N3S
and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 50772101 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine |
| SMILES | Cc1ccc(-c2cc3c(SC(C)C)nccn3n2)cc1C |
| InChI | InChI=1S/C17H19N3S/c1-11(2)21-17-16-10-15(19-20(16)8-7-18-17)14-6-5-12(3)13(4)9-14/h5-11H,1-4H3 |
| InChIKey | SOEBUBSBRBMWFC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine?
The IUPAC name of 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine (CID 50772101) is 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine is Cc1ccc(-c2cc3c(SC(C)C)nccn3n2)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine?
The InChIKey is SOEBUBSBRBMWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3S/c1-11(2)21-17-16-10-15(19-20(16)8-7-18-17)14-6-5-12(3)13(4)9-14/h5-11H,1-4H3.
What are the key properties of 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine?
2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine has a molecular weight of 297.43 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)-4-propan-2-ylsulfanylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 50772101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).