About 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide
2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide (PubChem CID 50775705) has the molecular formula C17H19BrN2O2S
and a molecular weight of 395.32 g/mol. Its IUPAC name is 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide.
Molecular Properties
| Compound Name | 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide |
| PubChem CID | 50775705 |
| Molecular Formula | C17H19BrN2O2S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide |
| SMILES | O=C(CSc1ncc(-c2cccc(Br)c2)o1)NC1CCCCC1 |
| InChI | InChI=1S/C17H19BrN2O2S/c18-13-6-4-5-12(9-13)15-10-19-17(22-15)23-11-16(21)20-14-7-2-1-3-8-14/h4-6,9-10,14H,1-3,7-8,11H2,(H,20,21) |
| InChIKey | PYTPLKDVFXHZCS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide?
The IUPAC name of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide (CID 50775705) is 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide.
What is the SMILES notation for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide?
The canonical SMILES for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide is O=C(CSc1ncc(-c2cccc(Br)c2)o1)NC1CCCCC1.
What is the InChIKey of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide?
The InChIKey is PYTPLKDVFXHZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19BrN2O2S/c18-13-6-4-5-12(9-13)15-10-19-17(22-15)23-11-16(21)20-14-7-2-1-3-8-14/h4-6,9-10,14H,1-3,7-8,11H2,(H,20,21).
What are the key properties of 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide?
2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide has a molecular weight of 395.32 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-cyclohexylacetamide is sourced from PubChem (CID 50775705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).