C27H27N3O2S — CID 50776641
3-(3,4-dimethylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 50776641) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 50776641 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | Cc1ccc(-c2c(C(=O)NCCCN3CCCC3=O)sc3c2cnc2ccccc23)cc1C |
| InChI | InChI=1S/C27H27N3O2S/c1-17-10-11-19(15-18(17)2)24-21-16-29-22-8-4-3-7-20(22)25(21)33-26(24)27(32)28-12-6-14-30-13-5-9-23(30)31/h3-4,7-8,10-11,15-16H,5-6,9,12-14H2,1-2H3,(H,28,32) |
| InChIKey | KIEUMJKKACVDGM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|